| Product Name | Methyl pentafluorophenyl carbonate |
| CAS No. | 36919-03-6 |
| Synonyms | Pentafluorophenyl methyl carbonate |
| InChI | InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
| Molecular Formula | C8H3F5O3 |
| Molecular Weight | 242.0996 |
| Density | 1.567g/cm3 |
| Boiling point | 207.5°C at 760 mmHg |
| Flash point | 77.3°C |
| Refractive index | 1.422 |
| Risk Codes | R22:Harmful if swallowed.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
36919-03-6 methyl pentafluorophenyl carbonate
service@apichina.com