| Product Name | methyl pentafluorobenzene |
| CAS No. | 771-56-2 |
| Synonyms | 2,3,4,5,6-Pentafluorotoluene; Methylpentafluorobenzene |
| InChI | InChI=1/C7H3F5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3 |
| Molecular Formula | C7H3F5 |
| Molecular Weight | 182.09 |
| Density | 1.44 |
| Boiling point | 117℃ |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
771-56-2 methyl pentafluorobenzene
service@apichina.com