| Product Name | methyl pentachlorophenyl sulfide |
| CAS No. | 1825-19-0 |
| Synonyms | Methyl pentachlorophenyl sulphide; Pentachlorothioanisole; 1,2,3,4,5-pentachloro-6-(methylsulfanyl)benzene |
| InChI | InChI=1/C7H3Cl5S/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h1H3 |
| Molecular Formula | C7H3Cl5S |
| Molecular Weight | 296.4287 |
| Density | 1.68g/cm3 |
| Boiling point | 318.5°C at 760 mmHg |
| Flash point | 139.6°C |
| Refractive index | 1.64 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
1825-19-0 methyl pentachlorophenyl sulfide
service@apichina.com