| Product Name | Methyl oxalyl chloride |
| CAS No. | 5781-53-3 |
| Synonyms | Methyl chloroglyoxylate; Monomethyl oxalyl chloride; methyl chlorooxoacetate; Chloroglyoxylic acid methyl ester |
| InChI | InChI=1/C3H3ClO3/c1-7-3(6)2(4)5/h1H3 |
| Molecular Formula | C3H3ClO3 |
| Molecular Weight | 122.5071 |
| Density | 1.36g/cm3 |
| Boiling point | 119°C at 760 mmHg |
| Flash point | 46.7°C |
| Refractive index | 1.416 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R10:Flammable.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S28A:After contact with skin, wash immediately with plenty of water.; S9:Keep container in a well-ventilated place.; |
5781-53-3 methyl oxalyl chloride
service@apichina.com