| Product Name | Methyl N-ethylcarbamate |
| CAS No. | 6135-31-5 |
| Synonyms | N-Ethylcarbamic acid methyl ester; methyl ethylcarbamate |
| InChI | InChI=1/C4H9NO2/c1-3-5-4(6)7-2/h3H2,1-2H3,(H,5,6) |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.1198 |
| Density | 0.964g/cm3 |
| Boiling point | 172°C at 760 mmHg |
| Flash point | 57.8°C |
| Refractive index | 1.4 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
6135-31-5 methyl n-ethylcarbamate
service@apichina.com