| Product Name | Methyl N-(chloroacetyl)carbamate |
| CAS No. | 13558-70-8 |
| Synonyms | methyl (chloroacetyl)carbamate |
| InChI | InChI=1/C4H6ClNO3/c1-9-4(8)6-3(7)2-5/h2H2,1H3,(H,6,7,8) |
| Molecular Formula | C4H6ClNO3 |
| Molecular Weight | 151.5483 |
| Density | 1.313g/cm3 |
| Refractive index | 1.447 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
13558-70-8 methyl n-(chloroacetyl)carbamate
service@apichina.com