| Product Name | Methyl isopropyl carbonate |
| CAS No. | 51729-83-0 |
| Synonyms | methyl 1-methylethyl carbonate |
| InChI | InChI=1/C5H10O3/c1-4(2)8-5(6)7-3/h4H,1-3H3 |
| Molecular Formula | C5H10O3 |
| Molecular Weight | 118.1311 |
| Density | 0.973g/cm3 |
| Boiling point | 106.7°C at 760 mmHg |
| Flash point | 34.9°C |
| Refractive index | 1.389 |
| Risk Codes | R10:Flammable.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
51729-83-0 methyl isopropyl carbonate
service@apichina.com