| Product Name | Methyl hydrogen phthalate |
| CAS No. | 4376-18-5 |
| Synonyms | Monomethyl phthalate~Phthalic acid monomethyl ester; mono-Methyl phthalate; Phthalic acid monomethyl ester; Benzene-1,2-dicarboxylic acid monomethyl ester~Monomethyl phthalate~Phthalic acid monomethyl ester; 2-(methoxycarbonyl)benzoic acid; 2-(methoxycarbonyl)benzoate |
| InChI | InChI=1/C9H8O4/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-5H,1H3,(H,10,11)/p-1 |
| Molecular Formula | C9H7O4 |
| Molecular Weight | 179.15 |
| Melting point | 81-84℃ |
| Boiling point | 328.9°C at 760 mmHg |
| Flash point | 134.7°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4376-18-5 methyl hydrogen phthalate
service@apichina.com