| Product Name | Methyl hydrogen isophthalate |
| CAS No. | 1877-71-0 |
| Synonyms | Monomethyl isophthalate; Isophthalic acid monomethyl ester; Benzene-1,3-dicarboxylic acid monomethyl ester; 3-(methoxycarbonyl)benzoic acid; Mono-methyl isophthalate |
| InChI | InChI=1/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11) |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.1574 |
| Density | 1.288g/cm3 |
| Melting point | 194-196℃ |
| Boiling point | 339.3°C at 760 mmHg |
| Flash point | 139.6°C |
| Refractive index | 1.556 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1877-71-0 methyl hydrogen isophthalate
service@apichina.com