| Product Name | METHYL GLUCETH-20 |
| CAS No. | 68239-42-9 |
| Synonyms | Poly(oxy-1,2-ethanediyl), alpha-hydro-omega-hydroxy-, ether with methyl beta-D-glucopyranoside (4:1); Ethoxylated methyl beta-D-glucoside; Methyl gluceth; UNII-J3QD0LD11P; Poly(oxy-1,2-ethanediyl), alpha-hydro-omega-hydroxy-, ether with methylbeta-D-glucopyranoside (4:1); Polyethylene glycol beta-methyl glucoside ether (4:1); methyl 2,3,4,6-tetrakis-O-(2-hydroxyethyl)-beta-D-glycero-hexopyranoside; MeG E-20; MeG E-10 |
| InChI | InChI=1/C15H30O10/c1-20-15-14(24-9-5-19)13(23-8-4-18)12(22-7-3-17)11(25-15)10-21-6-2-16/h11-19H,2-10H2,1H3/t11-,12?,13?,14?,15-/m1/s1 |
| Molecular Formula | C15H30O10 |
| Molecular Weight | 370.3927 |
| Density | 1.29g/cm3 |
| Boiling point | 562.6°C at 760 mmHg |
| Flash point | 294°C |
| Refractive index | 1.511 |
68239-42-9 methyl gluceth-20
service@apichina.com