| Product Name | methyl difluoroacetate |
| CAS No. | 433-53-4 |
| Synonyms | Difluoroacetic acid methyl ester; 1,1,2,3,3-pentafluoroprop-1-ene; Methyl 2,2-difluoroacetate |
| InChI | InChI=1/C3HF5/c4-1(2(5)6)3(7)8/h2H |
| Molecular Formula | C3HF5 |
| Molecular Weight | 132.0321 |
| Density | 1.335g/cm3 |
| Refractive index | 1.264 |
| Risk Codes | R11:Highly flammable.; R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S23:Do not inhale gas/fumes/vapour/spray.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
433-53-4 methyl difluoroacetate
service@apichina.com