| Product Name | Methyl benzoate |
| CAS No. | 93-58-3 |
| Synonyms | Benzoic acid methyl ester; clorius; essence of niobe; methyl benzenecarboxylate; Niobe oil; Oil of niobe; oniobe oil; oxidate le |
| InChI | InChI=1/C8H8O2/c1-10-8(9)7-5-3-2-4-6-7/h2-6H,1H3 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.1479 |
| Density | 1.069g/cm3 |
| Melting point | -12℃ |
| Boiling point | 199.5°C at 760 mmHg |
| Flash point | 80.2°C |
| Water solubility | <0.1 g/100 mL at 22.5℃ |
| Refractive index | 1.509 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:; |
| Safety | S36:; |
93-58-3 methyl benzoate
service@apichina.com