| Product Name | Methyl benzo(b)thiophene-2-carboxylate |
| CAS No. | 22913-24-2 |
| Synonyms | Methyl benzo[b]thiophene-2-carboxylate; Benzo[b]thiophene-2-carboxylic acid methyl ester~Methyl thianaphthene-2-carboxylate~Thianaphthene-2-carboxylic acid methyl ester; methyl benzothiophene-2-carboxylate; Methyl Benzothiophene Carboxylate |
| InChI | InChI=1/C10H8O2S/c1-12-10(11)9-6-7-4-2-3-5-8(7)13-9/h2-6H,1H3 |
| Molecular Formula | C10H8O2S |
| Molecular Weight | 192.2343 |
| Density | 1.274g/cm3 |
| Melting point | 69-70℃ |
| Boiling point | 304.586°C at 760 mmHg |
| Flash point | 138.009°C |
| Refractive index | 1.638 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
22913-24-2 methyl benzo(b)thiophene-2-carboxylate
service@apichina.com