| Product Name | methyl 6-morpholinonicotinate |
| CAS No. | 132546-81-7 |
| Synonyms | methyl 6-morpholin-4-ylpyridine-3-carboxylate |
| InChI | InChI=1/C11H14N2O3/c1-15-11(14)9-2-3-10(12-8-9)13-4-6-16-7-5-13/h2-3,8H,4-7H2,1H3 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.2405 |
| Density | 1.208g/cm3 |
| Melting point | 109℃ |
| Boiling point | 383.6°C at 760 mmHg |
| Flash point | 185.8°C |
| Refractive index | 1.542 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
132546-81-7 methyl 6-morpholinonicotinate
service@apichina.com