| Product Name | Methyl 5-methylnicotinate |
| CAS No. | 29681-45-6 |
| Synonyms | Methyl 5-methylpyridine-3-carboxylate; 5-Methylnicotinic acid methyl ester; 5-Methyl-nicotinic acid methyl ester |
| InChI | InChI=1/C8H9NO2/c1-6-3-7(5-9-4-6)8(10)11-2/h3-5H,1-2H3 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.1626 |
| Density | 1.104g/cm3 |
| Boiling point | 228.5°C at 760 mmHg |
| Flash point | 92°C |
| Refractive index | 1.51 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
29681-45-6 methyl 5-methylnicotinate
service@apichina.com