| Product Name | Methyl 5-(chloromethyl)-2-furoate |
| CAS No. | 2144-37-8 |
| Synonyms | methyl 5-(chloromethyl)furan-2-carboxylate; 5-CHLOROMETHYL-FURAN-2-CARBOXYLIC ACID METHYL ESTER |
| InChI | InChI=1/C7H7ClO3/c1-10-7(9)6-3-2-5(4-8)11-6/h2-3H,4H2,1H3 |
| Molecular Formula | C7H7ClO3 |
| Molecular Weight | 174.5817 |
| Density | 1.266g/cm3 |
| Melting point | 31℃ |
| Boiling point | 268.2°C at 760 mmHg |
| Flash point | 116°C |
| Refractive index | 1.493 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
2144-37-8 methyl 5-(chloromethyl)-2-furoate
service@apichina.com