| Product Name | Methyl 5-chloro-2-methoxybenzoate |
| CAS No. | 33924-48-0 |
| Synonyms | 5-Chloro-2-methoxybenzoic acid methyl ester; Methyl 5-chloro-o-anisate; 5-Chloro-o-anisic acid methyl ester (COOCH3=1); 5-Chloro-2-Methoxy Benzoic acid Methyl Ester |
| InChI | InChI=1/C9H9ClO3/c1-12-8-4-3-6(10)5-7(8)9(11)13-2/h3-5H,1-2H3 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.619 |
| Density | 1.228g/cm3 |
| Boiling point | 237.5°C at 760 mmHg |
| Flash point | 120.2°C |
| Refractive index | 1.519 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
33924-48-0 methyl 5-chloro-2-methoxybenzoate
service@apichina.com