| Product Name | methyl 5-bromo-4-methyl-2-thiophenecarboxylate |
| CAS No. | 54796-47-3 |
| Synonyms | methyl 5-bromo-4-methylthiophene-2-carboxylate |
| InChI | InChI=1/C7H7BrO2S/c1-4-3-5(7(9)10-2)11-6(4)8/h3H,1-2H3 |
| Molecular Formula | C7H7BrO2S |
| Molecular Weight | 235.0983 |
| Density | 1.575g/cm3 |
| Melting point | 39℃ |
| Boiling point | 275.6°C at 760 mmHg |
| Flash point | 120.5°C |
| Refractive index | 1.569 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
54796-47-3 methyl 5-bromo-4-methyl-2-thiophenecarboxylate
service@apichina.com