| Product Name | Methyl 5-amino-2-furoate |
| CAS No. | 22600-30-2 |
| Synonyms | 5-Aminofuran-2-carboxylic acid methyl ester~5-Amino-2-furoic acid methyl ester~Methyl 5-aminofuran-2-carboxylate; Methyl5-amino-2-furoate,(5-Amino-2-furoicacidmethyl ester); methyl 5-aminofuran-2-carboxylate |
| InChI | InChI=1/C6H7NO3/c1-9-6(8)4-2-3-5(7)10-4/h2-3H,7H2,1H3 |
| Molecular Formula | C6H7NO3 |
| Molecular Weight | 141.1247 |
| Density | 1.255g/cm3 |
| Boiling point | 277.9°C at 760 mmHg |
| Flash point | 121.9°C |
| Refractive index | 1.527 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
22600-30-2 methyl 5-amino-2-furoate
service@apichina.com