| Product Name | Methyl 4-(methylamino)benzoate |
| CAS No. | 18358-63-9 |
| Synonyms | Methyl 4-methylaminobenzoate; 4-Methylaminobenzoic acid methyl ester; Methyl4-methylaminobenzoate = 4-Methylaminobenzoicacid methylester |
| InChI | InChI=1/C9H11NO2/c1-10-8-5-3-7(4-6-8)9(11)12-2/h3-6,10H,1-2H3 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.1891 |
| Density | 1.125g/cm3 |
| Melting point | 92-94℃ |
| Boiling point | 277.5°C at 760 mmHg |
| Flash point | 121.6°C |
| Refractive index | 1.562 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
18358-63-9 methyl 4-(methylamino)benzoate
service@apichina.com