| Product Name | Methyl 4-methyl-2-pentenoate |
| CAS No. | 50652-78-3 |
| Synonyms | 4-Methyl-2-pentenoic acid methyl ester; methyl (2E)-4-methylpent-2-enoate |
| InChI | InChI=1/C7H12O2/c1-6(2)4-5-7(8)9-3/h4-6H,1-3H3/b5-4+ |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.169 |
| Density | 0.905g/cm3 |
| Boiling point | 142.7°C at 760 mmHg |
| Flash point | 40°C |
| Refractive index | 1.425 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
50652-78-3 methyl 4-methyl-2-pentenoate
service@apichina.com