| Product Name | Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate |
| CAS No. | 39493-62-4 |
| Synonyms | 5,6-Dihydroorsellinic acid methyl ester~4-Hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate methyl ester~Methyl 5-methylcyclohexene-1,3-dione-4-carboxylate; methyl 4-hydroxy-6-methyl-2-oxocyclohex-3-ene-1-carboxylate |
| InChI | InChI=1/C9H12O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h4-5,8,10H,3H2,1-2H3 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.1892 |
| Density | 1.237g/cm3 |
| Boiling point | 289.4°C at 760 mmHg |
| Flash point | 113°C |
| Refractive index | 1.511 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
39493-62-4 methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate
service@apichina.com