| Product Name | Methyl 4-hydroxy-3-nitrobenzoate |
| CAS No. | 99-42-3 |
| Synonyms | 4-Hydroxy-3-nitrobenzoic acid methyl ester; Methyl 3-nitro-4-hydroxybenzoate; 4-(methoxycarbonyl)-2-nitrophenolate; 3-nitro-4-hydroxymethyl benzoate |
| InChI | InChI=1/C8H7NO5/c1-14-8(11)5-2-3-7(10)6(4-5)9(12)13/h2-4,10H,1H3/p-1 |
| Molecular Formula | C8H6NO5 |
| Molecular Weight | 196.1375 |
| Melting point | 74-76℃ |
| Boiling point | 311.1°C at 760 mmHg |
| Flash point | 141.9°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
99-42-3 methyl 4-hydroxy-3-nitrobenzoate
service@apichina.com