| Product Name | methyl 4-formyl-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| CAS No. | 175205-91-1 |
| InChI | InChI=1/C9H11NO3/c1-5-7(4-11)8(6(2)10-5)9(12)13-3/h4,10H,1-3H3 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.1885 |
| Density | 1.209g/cm3 |
| Melting point | 179℃ |
| Boiling point | 386.7°C at 760 mmHg |
| Flash point | 187.7°C |
| Refractive index | 1.565 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175205-91-1 methyl 4-formyl-2,5-dimethyl-1h-pyrrole-3-carboxylate
service@apichina.com