| Product Name | methyl 4-formyl-1-methyl-1H-pyrrole-2-carboxylate |
| CAS No. | 67858-47-3 |
| Synonyms | 4-Formyl-2-methoxycarbonyl-N-methylpyrrole; methyl 4-formyl-1H-pyrrole-2-carboxylate |
| InChI | InChI=1/C8H9NO3/c1-9-4-6(5-10)3-7(9)8(11)12-2/h3-5H,1-2H3 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.162 |
| Density | 1.16g/cm3 |
| Melting point | 96℃ |
| Boiling point | 293.1°C at 760 mmHg |
| Flash point | 131.1°C |
| Refractive index | 1.521 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
67858-47-3 methyl 4-formyl-1-methyl-1h-pyrrole-2-carboxylate
service@apichina.com