| Product Name | Methyl 4-dimethylaminobenzoate |
| CAS No. | 1202-25-1 |
| Synonyms | 4-Dimethylaminobenzoic acid methyl ester |
| InChI | InChI=1/C10H13NO2/c1-11(2)9-6-4-8(5-7-9)10(12)13-3/h4-7H,1-3H3 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.2157 |
| Density | 1.084g/cm3 |
| Melting point | 100-102℃ |
| Boiling point | 280.3°C at 760 mmHg |
| Flash point | 112.6°C |
| Refractive index | 1.545 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
1202-25-1 methyl 4-dimethylaminobenzoate
service@apichina.com