| Product Name | methyl 4-cyanobenzoate |
| CAS No. | 1129-35-7 |
| Synonyms | 4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
| InChI | InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.1574 |
| Density | 1.18g/cm3 |
| Melting point | 62℃ |
| Boiling point | 274.9°C at 760 mmHg |
| Flash point | 131.2°C |
| Refractive index | 1.535 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
1129-35-7 methyl 4-cyanobenzoate
service@apichina.com