| Product Name | Methyl 4-chlorocinnamate |
| CAS No. | 7560-44-3 |
| Synonyms | 4-Chlorocinnamic acid methyl ester; methyl 3-(4-chlorophenyl)prop-2-enoate; methyl (2E)-3-(4-chlorophenyl)prop-2-enoate |
| InChI | InChI=1/C10H9ClO2/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7H,1H3/b7-4+ |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.6303 |
| Density | 1.211g/cm3 |
| Melting point | 76-77℃ |
| Boiling point | 292.8°C at 760 mmHg |
| Flash point | 144.4°C |
| Refractive index | 1.572 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
7560-44-3 methyl 4-chlorocinnamate
service@apichina.com