| Product Name | Methyl 4-Chloro-2-Nitrobenzoate |
| CAS No. | 42087-80-9 |
| Synonyms | 4-Chloro-2-nitrobenzoic acid methyl ester |
| InChI | InChI=1/C8H6ClNO4/c1-14-8(11)6-3-2-5(9)4-7(6)10(12)13/h2-4H,1H3 |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.5905 |
| Density | 1.426g/cm3 |
| Melting point | 43-45℃ |
| Boiling point | 285.6°C at 760 mmHg |
| Flash point | 126.5°C |
| Refractive index | 1.568 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
42087-80-9 methyl 4-chloro-2-nitrobenzoate
service@apichina.com