| Product Name | Methyl 4-bromo-3-hydroxythiophene-2-carboxylate |
| CAS No. | 95201-93-7 |
| Synonyms | 4-bromo-2-[hydroxy(methoxy)methylidene]thiophen-3(2H)-one |
| InChI | InChI=1/C6H5BrO3S/c1-10-6(9)5-4(8)3(7)2-11-5/h2,8H,1H3 |
| Molecular Formula | C6H5BrO3S |
| Molecular Weight | 237.0711 |
| Density | 1.804g/cm3 |
| Melting point | 79-80℃ |
| Boiling point | 247.887°C at 760 mmHg |
| Flash point | 103.718°C |
| Refractive index | 1.617 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
95201-93-7 methyl 4-bromo-3-hydroxythiophene-2-carboxylate
service@apichina.com