| Product Name | Methyl 4-biphenylcarboxylate |
| CAS No. | 720-75-2 |
| Synonyms | P-phenylbenzoic acid methyl ester; p-Phenylbenzoic acid-OMe; Methyl 4-Phenylbenzoate; 4-Biphenylcarboxylic acid methyl ester~Methyl 4-phenylbenzoate; methyl biphenyl-4-carboxylate; methyl 4-phenylcyclohexanecarboxylate |
| InChI | InChI=1/C14H18O2/c1-16-14(15)13-9-7-12(8-10-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.2915 |
| Density | 1.048g/cm3 |
| Melting point | 118℃ |
| Boiling point | 307.8°C at 760 mmHg |
| Flash point | 132.7°C |
| Refractive index | 1.517 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
720-75-2 methyl 4-biphenylcarboxylate
service@apichina.com