| Product Name | methyl 4-acetyl-1,2,5-trimethyl-1H-pyrrole-3-carboxylate |
| CAS No. | 175276-48-9 |
| InChI | InChI=1/C11H15NO3/c1-6-9(8(3)13)10(11(14)15-5)7(2)12(6)4/h1-5H3 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.2417 |
| Density | 1.1g/cm3 |
| Melting point | 83℃ |
| Boiling point | 342.1°C at 760 mmHg |
| Flash point | 160.7°C |
| Refractive index | 1.514 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175276-48-9 methyl 4-acetyl-1,2,5-trimethyl-1h-pyrrole-3-carboxylate
service@apichina.com