| Product Name | methyl 4,5-dichloroisothiazole-3-carboxylate |
| CAS No. | 166668-76-4 |
| Synonyms | methyl 4,5-dichloro-1,2-thiazole-3-carboxylate |
| InChI | InChI=1/C5H3Cl2NO2S/c1-10-5(9)3-2(6)4(7)11-8-3/h1H3 |
| Molecular Formula | C5H3Cl2NO2S |
| Molecular Weight | 212.0538 |
| Density | 1.583g/cm3 |
| Melting point | 52℃ |
| Boiling point | 207.5°C at 760 mmHg |
| Flash point | 79.3°C |
| Refractive index | 1.575 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
166668-76-4 methyl 4,5-dichloroisothiazole-3-carboxylate
service@apichina.com