| Product Name | Methyl 3-methylaminocrotonate |
| CAS No. | 13412-12-9 |
| Synonyms | methyl 3-(methylamino)but-2-enoate; methyl (2Z)-3-(methylamino)but-2-enoate; methyl (2E)-3-(methylamino)but-2-enoate; methyl (3E)-3-(methylimino)butanoate |
| InChI | InChI=1/C6H11NO2/c1-5(7-2)4-6(8)9-3/h4H2,1-3H3/b7-5+ |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.157 |
| Density | 0.95g/cm3 |
| Melting point | 60-63℃ |
| Boiling point | 169°C at 760 mmHg |
| Flash point | 58.8°C |
| Refractive index | 1.431 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
13412-12-9 methyl 3-methylaminocrotonate
service@apichina.com