| Product Name | methyl 3-methyl-2-oxobutanoate |
| CAS No. | 3952-67-8 |
| Synonyms | Butanoic acid, 3-methyl-2-oxo-, methyl ester; Methyl 3-methyl-2-oxobutanoate |
| InChI | InChI=1/C6H10O3/c1-4(2)5(7)6(8)9-3/h4H,1-3H3 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.1418 |
| Density | 1.012g/cm3 |
| Boiling point | 161.852°C at 760 mmHg |
| Flash point | 56.313°C |
| Refractive index | 1.406 |
3952-67-8 methyl 3-methyl-2-oxobutanoate
service@apichina.com