| Product Name | Methyl 3-methoxy-4-methylbenzoate |
| CAS No. | 3556-83-0 |
| Synonyms | 3-Methoxy-4-methylbenzoic acid methyl ester; 3-Methoxy-p-toluic acid methyl ester (COOCH3=1); methyl 4-methoxy-3-methylbenzoate |
| InChI | InChI=1/C10H12O3/c1-7-6-8(10(11)13-3)4-5-9(7)12-2/h4-6H,1-3H3 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2005 |
| Density | 1.075g/cm3 |
| Melting point | 50-120℃ |
| Boiling point | 269.5°C at 760 mmHg |
| Flash point | 107.5°C |
| Refractive index | 1.502 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
3556-83-0 methyl 3-methoxy-4-methylbenzoate
service@apichina.com