| Product Name | Methyl 3-isothiocyanatopropionate |
| CAS No. | 18967-35-6 |
| Synonyms | 3-Isothiocyanatopropionic acid methyl ester; methyl N-(thioxomethylidene)-beta-alaninate |
| InChI | InChI=1/C5H7NO2S/c1-8-5(7)2-3-6-4-9/h2-3H2,1H3 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.1796 |
| Density | 1.12g/cm3 |
| Boiling point | 226°C at 760 mmHg |
| Flash point | 90.5°C |
| Refractive index | 1.5 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
18967-35-6 methyl 3-isothiocyanatopropionate
service@apichina.com