| Product Name | Methyl 3-hydroxy-4-nitrobenzoate |
| CAS No. | 713-52-0 |
| Synonyms | 3-Hydroxy-4-nitrobenzoic acid methyl ester; 5-(methoxycarbonyl)-2-nitrophenolate |
| InChI | InChI=1/C8H7NO5/c1-14-8(11)5-2-3-6(9(12)13)7(10)4-5/h2-4,10H,1H3/p-1 |
| Molecular Formula | C8H6NO5 |
| Molecular Weight | 196.1375 |
| Boiling point | 346.4°C at 760 mmHg |
| Flash point | 163.3°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
713-52-0 methyl 3-hydroxy-4-nitrobenzoate
service@apichina.com