| Product Name | methyl 3-hydrazinothiophene-2-carboxylate |
| CAS No. | 75681-13-9 |
| InChI | InChI=1/C6H8N2O2S/c1-10-6(9)5-4(8-7)2-3-11-5/h2-3,8H,7H2,1H3 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.2049 |
| Density | 1.395g/cm3 |
| Melting point | 69℃ |
| Boiling point | 328.9°C at 760 mmHg |
| Flash point | 152.7°C |
| Refractive index | 1.648 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
75681-13-9 methyl 3-hydrazinothiophene-2-carboxylate
service@apichina.com