| Product Name | methyl 3-formylbenzoate |
| CAS No. | 52178-50-4 |
| Synonyms | Methyl benzaldehyde-4-carboxylate |
| InChI | InChI=1/C9H8O3/c1-12-9(11)8-4-2-3-7(5-8)6-10/h2-6H,1H3 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.158 |
| Density | 1.181g/cm3 |
| Melting point | 48-55℃ |
| Boiling point | 272.8°C at 760 mmHg |
| Flash point | 118.2°C |
| Refractive index | 1.557 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
52178-50-4 methyl 3-formylbenzoate
service@apichina.com