| Product Name | Methyl 3-cyano-4-methoxybenzoate |
| CAS No. | 25978-74-9 |
| Synonyms | 3-Cyano-4-methoxybenzoic acid methyl ester |
| InChI | InChI=1/C10H9NO3/c1-13-9-4-3-7(10(12)14-2)5-8(9)6-11/h3-5H,1-2H3 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.1834 |
| Density | 1.2g/cm3 |
| Melting point | 126℃ |
| Boiling point | 339.7°C at 760 mmHg |
| Flash point | 148.2°C |
| Refractive index | 1.527 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
25978-74-9 methyl 3-cyano-4-methoxybenzoate
service@apichina.com