| Product Name | Methyl 3-chlorothiophene-2-carboxylate |
| CAS No. | 88105-17-3 |
| InChI | InChI=1/C6H5ClO2S/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,1H3 |
| Molecular Formula | C6H5ClO2S |
| Molecular Weight | 176.6207 |
| Density | 1.371g/cm3 |
| Melting point | 37-74℃ |
| Boiling point | 239°C at 760 mmHg |
| Flash point | 98.3°C |
| Refractive index | 1.554 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
88105-17-3 methyl 3-chlorothiophene-2-carboxylate
service@apichina.com