| Product Name | methyl 3-(chlorosulfonyl)-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylate |
| CAS No. | 306935-98-8 |
| Synonyms | 1-{2-[(2-chloro-6-fluorobenzyl)sulfanyl]ethyl}-2-methyl-5-phenyl-1H-pyrrole-3-carboxylic acid |
| InChI | InChI=1/C21H19ClFNO2S/c1-14-16(21(25)26)12-20(15-6-3-2-4-7-15)24(14)10-11-27-13-17-18(22)8-5-9-19(17)23/h2-9,12H,10-11,13H2,1H3,(H,25,26) |
| Molecular Formula | C21H19ClFNO2S |
| Molecular Weight | 403.8975 |
| Density | 1.27g/cm3 |
| Melting point | 68℃ |
| Boiling point | 566.6°C at 760 mmHg |
| Flash point | 296.5°C |
| Refractive index | 1.608 |
| Hazard Symbols | |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
306935-98-8 methyl 3-(chlorosulfonyl)-4-phenyl-5-(trifluoromethyl)thiophene-2-carboxylate
service@apichina.com