| Product Name | Methyl 3-chlorobenzo(b)thiophene-2-carboxylate |
| CAS No. | 21211-07-4 |
| Synonyms | Methylchlorobenzobthiophenecarboxylate; methyl 3-chloro-1-benzothiophene-2-carboxylate; Methyl 3-chlorobenzo[b]thiophene-2-carboxylate |
| InChI | InChI=1/C10H7ClO2S/c1-13-10(12)9-8(11)6-4-2-3-5-7(6)14-9/h2-5H,1H3 |
| Molecular Formula | C10H7ClO2S |
| Molecular Weight | 226.6794 |
| Density | 1.391g/cm3 |
| Melting point | 80-82℃ |
| Boiling point | 338.8°C at 760 mmHg |
| Flash point | 158.7°C |
| Refractive index | 1.646 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
21211-07-4 methyl 3-chlorobenzo(b)thiophene-2-carboxylate
service@apichina.com