| Product Name | Methyl 3-chloro-4-methylthiophene-2-carboxylate |
| CAS No. | 175137-11-8 |
| InChI | InChI=1/C7H7ClO2S/c1-4-3-11-6(5(4)8)7(9)10-2/h3H,1-2H3 |
| Molecular Formula | C7H7ClO2S |
| Molecular Weight | 190.6473 |
| Density | 1.314g/cm3 |
| Melting point | 75-77℃ |
| Boiling point | 263.3°C at 760 mmHg |
| Flash point | 113.1°C |
| Refractive index | 1.548 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175137-11-8 methyl 3-chloro-4-methylthiophene-2-carboxylate
service@apichina.com