| Product Name | Methyl 3-aminothiophene-4-carboxylate hydrochloride |
| CAS No. | 39978-14-8 |
| Synonyms | methyl 4-aminothiophene-3-carboxylate hydrochloride; methyl 4-aminothiophene-3-carboxylate |
| InChI | InChI=1/C6H7NO2S/c1-9-6(8)4-2-10-3-5(4)7/h2-3H,7H2,1H3 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.1903 |
| Density | 1.319g/cm3 |
| Melting point | 203℃ |
| Boiling point | 295.9°C at 760 mmHg |
| Flash point | 132.8°C |
| Refractive index | 1.598 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
39978-14-8 methyl 3-aminothiophene-4-carboxylate hydrochloride
service@apichina.com