| Product Name | methyl 3-amino-5,6-dichloro-2-pyrazine-carboxylat |
| CAS No. | 1458-18-0 |
| Synonyms | Methyl 3-amino-5,6-dichloro-2-pyrazinecarboxylate; 3-Amino-5,6-Dichloropyrazine-2-Carboxylic Acid Methyl Ester; methyl 3-amino-5,6-dichloropyrazine-2-carboxylate |
| InChI | InChI=1/C6H5Cl2N3O2/c1-13-6(12)2-5(9)11-4(8)3(7)10-2/h1H3,(H2,9,11) |
| Molecular Formula | C6H5Cl2N3O2 |
| Molecular Weight | 222.0288 |
| Density | 1.586g/cm3 |
| Melting point | 230-233℃ |
| Boiling point | 357.3°C at 760 mmHg |
| Flash point | 169.9°C |
| Refractive index | 1.605 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20:Harmful by inhalation.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1458-18-0 methyl 3-amino-5,6-dichloro-2-pyrazine-carboxylat
service@apichina.com