| Product Name | methyl 3-amino-4-cyanothiophene-2-carboxylate |
| CAS No. | 102123-28-4 |
| InChI | InChI=1/C7H6N2O2S/c1-11-7(10)6-5(9)4(2-8)3-12-6/h3H,9H2,1H3 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.1997 |
| Density | 1.4g/cm3 |
| Melting point | 151℃ |
| Boiling point | 384.6°C at 760 mmHg |
| Flash point | 186.4°C |
| Refractive index | 1.597 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
102123-28-4 methyl 3-amino-4-cyanothiophene-2-carboxylate
service@apichina.com