| Product Name | methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate |
| CAS No. | 499771-09-4 |
| Synonyms | methyl 3-amino-4-cyano-5-piperidin-1-ylthiophene-2-carboxylate |
| InChI | InChI=1/C12H15N3O2S/c1-17-12(16)10-9(14)8(7-13)11(18-10)15-5-3-2-4-6-15/h2-6,14H2,1H3 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.3314 |
| Density | 1.33g/cm3 |
| Melting point | 183℃ |
| Boiling point | 506.1°C at 760 mmHg |
| Flash point | 259.9°C |
| Refractive index | 1.613 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
499771-09-4 methyl 3-amino-4-cyano-5-piperidinothiophene-2-carboxylate
service@apichina.com