| Product Name | methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate |
| CAS No. | 129332-45-2 |
| Synonyms | methyl 3-amino-4-cyano-5-(methylsulfanyl)thiophene-2-carboxylate |
| InChI | InChI=1/C8H8N2O2S2/c1-12-7(11)6-5(10)4(3-9)8(13-2)14-6/h10H2,1-2H3 |
| Molecular Formula | C8H8N2O2S2 |
| Molecular Weight | 228.2913 |
| Density | 1.43g/cm3 |
| Melting point | 203℃ |
| Boiling point | 442.2°C at 760 mmHg |
| Flash point | 221.2°C |
| Refractive index | 1.63 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
129332-45-2 methyl 3-amino-4-cyano-5-(methylthio)thiophene-2-carboxylate
service@apichina.com